Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sparsentan (RE-021) is a highly potent dual angiotensin II and endothelin A receptor antagonist with Kis of 0.8 and 9.3 nM, respectively. |
|---|
| Catalog Num | A20879 |
|---|---|
| Formula | C32H40N4O5S |
| Molecular Weight | 592.75 |
| CAS Number | 254740-64-2 |
| SMILES | O=S(C1=CC=CC=C1C2=CC=C(CN3C(CCCC)=NC4(CCCC4)C3=O)C=C2COCC)(NC5=NOC(C)=C5C)=O |
| Synonyms | RE-021, RE021, RE 021; DARA-a |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (156.89 mM) | |
| Water | Insoluble | ||
| Ethanol | 37 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.87 mL | 84.35 mL | 168.71 mL |
| 0.5 mM | 3.37 mL | 16.87 mL | 33.74 mL |
| 1 mM | 1.69 mL | 8.44 mL | 16.87 mL |
| 5 mM | 0.34 mL | 1.69 mL | 3.37 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
