Loading distributor info...
| Description | Spiradine A is a C20 diterpenoid alkaloid primarily targeting inflammatory pathways. Isolated from the roots of Thalictrum sessile and Spiraea japonica, Spiradine A demonstrates potential anti-inflammatory and analgesic activities. This compound may be useful in research focused on pain management and inflammation-related disorders. |
|---|
| Catalog Num | B19835 |
|---|---|
| Formula | C20H25NO2 |
| Molecular Weight | 311.42 |
| CAS Number | 19741-46-9 |
| SMILES | O[C@]12[C@@]3([H])[C@@]45[C@@]6([H])[C@@]7(C2)[C@@](C[C@@](C(C7)=C)([H])C6=O)([H])[C@@]4([H])[N@]1C[C@@]3(CCC5)C |
| Synonyms | 6-Hydroxyhetisan-11-one |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
