Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SRT 2183 is a selective Sirtuin-1 (SIRT1) activator with an EC1.5 value of 0.36 μM. SRT 2183 induces growth arrest and apoptosis, concomitant with deacetylation of STAT3 and NF-κB, and reduction of c-Myc protein levels. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12150 |
|---|---|
| Formula | C27H24N4O2S |
| Molecular Weight | 468.57 |
| CAS Number | 1001908-89-9 |
| SMILES | O=C(NC1=C(C2=CN3C(SC=C3CN4CC[C@@H](O)C4)=N2)C=CC=C1)C(C=C5)=CC6=C5C=CC=C6 |
| Synonyms | SRT2183, SRT-2183 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (183.53 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (6.4 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.34 mL | 106.71 mL | 213.42 mL |
| 0.5 mM | 4.27 mL | 21.34 mL | 42.68 mL |
| 1 mM | 2.13 mL | 10.67 mL | 21.34 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
