Loading distributor info...
| Description | ST-162 is a dual antagonist of the MAPK and PI3K signaling pathways. It demonstrates significant antitumor activity and has been shown to enhance the efficacy of immune checkpoint inhibitors. This compound is suitable for cancer research, particularly in the study of melanoma and other malignancies. |
|---|
| Catalog Num | A40845 |
|---|---|
| Formula | C40H44F5IN10O6 |
| Molecular Weight | 982.74 |
| CAS Number | 1883817-83-1 |
| SMILES | O=C(NOCCOCCOCCOCCN1CCN(C2=NC(N3C4=CC=CC=C4N=C3C(F)F)=NC(N5CCOCC5)=N2)CC1)C6=CC=C(F)C(F)=C6NC7=CC=C(I)C=C7F |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
