Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | STAT3-IN-1 (compound 7d) is an excellent, selective and orally active STAT3 inhibitor, with IC50 values of 1.82 μM and 2.14 μM in HT29 and MDA-MB 231 cells, respectively. STAT3-IN-1 (compound 7d) induces tumor apoptosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12232 |
|---|---|
| Formula | C28H29NO6 |
| Molecular Weight | 475.53 |
| CAS Number | 2059952-75-7 |
| SMILES | COC1=CC(OC)=CC(/C=C/C2=CC=C(NC(/C=C/C3=CC(OC)=C(OC)C(OC)=C3)=O)C=C2)=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (170.33 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (8.41 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.03 mL | 105.15 mL | 210.29 mL |
| 0.5 mM | 4.21 mL | 21.03 mL | 42.06 mL |
| 1 mM | 2.1 mL | 10.51 mL | 21.03 mL |
| 5 mM | 0.42 mL | 2.1 mL | 4.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
