Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SU14813 is an oral, multitargeted tyrosine kinase inhibitor (TKI) targeting vascular endothelial growth factor receptors (VEGFR), platelet-derived growth factor receptors (PDGFR), KIT, and fms-like tyrosine kinase 3 (FLT-3) | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11557 |
|---|---|
| Formula | C23H27FN4O4 |
| Molecular Weight | 442.48 |
| CAS Number | 627908-92-3 |
| SMILES | CC1=C(NC(=C1C(=O)NC[C@@H](CN2CCOCC2)O)C)/C=C\3/C4=C(C=CC(=C4)F)NC3=O |
| Synonyms | SU14813; SU 14813; SU-14813 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (178.53 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.6 mL | 113 mL | 226 mL |
| 0.5 mM | 4.52 mL | 22.6 mL | 45.2 mL |
| 1 mM | 2.26 mL | 11.3 mL | 22.6 mL |
| 5 mM | 0.45 mL | 2.26 mL | 4.52 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
