Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Succinobucol is a phenolic antioxidant with anti-inflammatory and antiplatelet effects. |
|---|
| Catalog Num | A21251 |
|---|---|
| Formula | C35H52O5S2 |
| Molecular Weight | 616.91 |
| CAS Number | 216167-82-7 |
| SMILES | CC(C)(C)C1=CC(SC(C)(C)SC2=CC(C(C)(C)C)=C(OC(CCC(O)=O)=O)C(C(C)(C)C)=C2)=CC(C(C)(C)C)=C1O |
| Synonyms | AGI-1067; Probucol monosuccinate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (145.88 mM) | |
| Water | Insoluble | ||
| Ethanol | 45 mg/mL (72.94 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.21 mL | 81.05 mL | 162.1 mL |
| 0.5 mM | 3.24 mL | 16.21 mL | 32.42 mL |
| 1 mM | 1.62 mL | 8.1 mL | 16.21 mL |
| 5 mM | 0.32 mL | 1.62 mL | 3.24 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
