Loading distributor info...
| Description | Sulpiride is a dopamine D2-receptor antagonist. It has been used therapeutically as an antidepressant, antipsychotic, and as a digestive aid. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A16133 |
|---|---|
| Formula | C15H23N3O4S |
| Molecular Weight | 341.43 |
| CAS Number | 15676-16-1 |
| SMILES | O=C(NCC1N(CC)CCC1)C2=CC(S(=O)(N)=O)=CC=C2OC |
| Synonyms | CCRIS-4248, CCRIS4248, CCRIS 4248 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (190.37 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.29 mL | 146.44 mL | 292.89 mL |
| 0.5 mM | 5.86 mL | 29.29 mL | 58.58 mL |
| 1 mM | 2.93 mL | 14.64 mL | 29.29 mL |
| 5 mM | 0.59 mL | 2.93 mL | 5.86 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
