Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | T56-LIMKi is a selective inhibitor of LIMK2; inhibits the growth of Panc-1 cells with an IC50 of 35.2 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12266 |
|---|---|
| Formula | C19H14F3N3O3 |
| Molecular Weight | 389.33 |
| CAS Number | 924473-59-6 |
| SMILES | O=C(C1=CC(C)=NO1)NC2=CC=CC(C(NC3=CC=CC(C(F)(F)F)=C3)=O)=C2 |
| Synonyms | T5601640, T 5601640, T-5601640 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (197.77 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (7.7 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.69 mL | 128.43 mL | 256.85 mL |
| 0.5 mM | 5.14 mL | 25.69 mL | 51.37 mL |
| 1 mM | 2.57 mL | 12.84 mL | 25.69 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.14 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
