Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tasquinimod is an orally active antiangiogenic agent by allosterically inhibiting HDAC4 signalling. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12616 |
|---|---|
| Formula | C20H17F3N2O4 |
| Molecular Weight | 406.36 |
| CAS Number | 254964-60-8 |
| SMILES | CN1C2=C(C(=CC=C2)OC)C(=C(C1=O)C(=O)N(C)C3=CC=C(C=C3)C(F)(F)F)O |
| Synonyms | ABR-215050 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 78 mg/mL (191.95 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 11 mg/mL (27.06 mM) | ||
| In vivo | 5% DMSO+30% PEG 300+ddH2O | 7 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.61 mL | 123.04 mL | 246.09 mL |
| 0.5 mM | 4.92 mL | 24.61 mL | 49.22 mL |
| 1 mM | 2.46 mL | 12.3 mL | 24.61 mL |
| 5 mM | 0.49 mL | 2.46 mL | 4.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
