Loading distributor info...
| Description | Tectochrysin (Techtochrysin) is one of the major flavonoids of Alpinia oxyphylla Miquel. Tectochrysin (Techtochrysin) inhibits activity of NF-κB. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15679 |
|---|---|
| Formula | C16H12O4 |
| Molecular Weight | 268.26 |
| CAS Number | 520-28-5 |
| SMILES | OC1=C2C(OC(C3=CC=CC=C3)=CC2=O)=CC(OC)=C1 |
| Synonyms | Techtochrysin; NSC 80687, NSC-80687, NSC80687 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 6 mg/mL (22.36 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.28 mL | 186.39 mL | 372.77 mL |
| 0.5 mM | 7.46 mL | 37.28 mL | 74.55 mL |
| 1 mM | 3.73 mL | 18.64 mL | 37.28 mL |
| 5 mM | 0.75 mL | 3.73 mL | 7.46 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
