Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | TEPP-46 is a potent and selective activator of recombinant pyruvate kinase M2 (PKM2) with half-maximum activating concentration (AC50 value) of 92 nM, and little or no activity versus PKM1, PKL and PKR. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A16279 |
|---|---|
| Formula | C17H16N4O2S2 |
| Molecular Weight | 372.46 |
| CAS Number | 1221186-53-3 |
| SMILES | O=C1C(N(C)C2=C3SC(S(C)=O)=C2)=C3C=NN1CC4=CC=CC(N)=C4 |
| Synonyms | ML-265 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 73 mg/mL (195.99 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.85 mL | 134.24 mL | 268.49 mL |
| 0.5 mM | 5.37 mL | 26.85 mL | 53.7 mL |
| 1 mM | 2.68 mL | 13.42 mL | 26.85 mL |
| 5 mM | 0.54 mL | 2.68 mL | 5.37 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
