Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TG003 is a potent, specific, reversible, and ATP competitive inhibitor of Cdc2 like kinase(Clk).- | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13721 |
|---|---|
| Formula | C13H15NO2S |
| Molecular Weight | 249.3 |
| CAS Number | 300801-52-9 |
| SMILES | CCN\1C2=C(C=CC(=C2)OC)S/C1=C\C(=O)C |
| Synonyms | TG-003, TG-003 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 5 mg/mL (20.05 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.11 mL | 200.56 mL | 401.12 mL |
| 0.5 mM | 8.02 mL | 40.11 mL | 80.22 mL |
| 1 mM | 4.01 mL | 20.06 mL | 40.11 mL |
| 5 mM | 0.8 mL | 4.01 mL | 8.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
