Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Theophylline-7-acetic acid (Acefylline), acting as an adenosine receptor antagonist, is a stimulant drug of the xanthine chemical class. |
|---|
| Catalog Num | A16822 |
|---|---|
| Formula | C9H10N4O4 |
| Molecular Weight | 238.2 |
| CAS Number | 652-37-9 |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (193.11 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.98 mL | 209.91 mL | 419.82 mL |
| 0.5 mM | 8.4 mL | 41.98 mL | 83.96 mL |
| 1 mM | 4.2 mL | 20.99 mL | 41.98 mL |
| 5 mM | 0.84 mL | 4.2 mL | 8.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
