Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Thioridazine is a dopamine receptor antagonist that displays antipsychotic activity. Recently thioridazine is also reported to successfully kill human cancer stem cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11119 |
|---|---|
| Formula | C21H26N2S2.HCl |
| Molecular Weight | 407 |
| CAS Number | 130-61-0 |
| SMILES | CN1CCCCC1CCN2C3=CC=CC=C3SC4=C2C=C(C=C4)SC.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (184.25 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.57 mL | 122.85 mL | 245.7 mL |
| 0.5 mM | 4.91 mL | 24.57 mL | 49.14 mL |
| 1 mM | 2.46 mL | 12.29 mL | 24.57 mL |
| 5 mM | 0.49 mL | 2.46 mL | 4.91 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
