Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | THZ2 is a potent and selective CDK7 inhibitor with an IC50 of 13.9 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A22026 |
|---|---|
| Formula | C31H28ClN7O2 |
| Molecular Weight | 566.05 |
| CAS Number | 1604810-84-5 |
| SMILES | O=C(NC1=CC=CC(NC2=NC=C(Cl)C(C3=CNC4=C3C=CC=C4)=N2)=C1)C5=CC=CC(NC(/C=C/CN(C)C)=O)=C5 |
| Synonyms | THZ 2, THZ-2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (164.29 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.67 mL | 88.33 mL | 176.66 mL |
| 0.5 mM | 3.53 mL | 17.67 mL | 35.33 mL |
| 1 mM | 1.77 mL | 8.83 mL | 17.67 mL |
| 5 mM | 0.35 mL | 1.77 mL | 3.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
