Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tinoridine hydrochloride is a nonsteroidal anti-inflammatory drug and also has potent radical scavenger and antiperoxidative activity. |
|---|
| Catalog Num | A18023 |
|---|---|
| Formula | C17H21ClN2O2S |
| Molecular Weight | 352.88 |
| CAS Number | 25913-34-2 |
| SMILES | O=C(C1=C(N)SC2=C1CCN(CC3=CC=CC=C3)C2)OCC.Cl |
| Synonyms | Y-3642 hydrochloride, Y3642, Y 3642 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 17 mg/mL (48.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.34 mL | 141.69 mL | 283.38 mL |
| 0.5 mM | 5.67 mL | 28.34 mL | 56.68 mL |
| 1 mM | 2.83 mL | 14.17 mL | 28.34 mL |
| 5 mM | 0.57 mL | 2.83 mL | 5.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
