Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TM5275 sodium is a plasminogen activator inhibitor (PAI-1) with an IC50 of 6.95 μM. |
|---|
| Catalog Num | A20462 |
|---|---|
| Formula | C28H28ClN3NaO5 |
| Molecular Weight | 544.98 |
| CAS Number | 1103926-82-4 |
| SMILES | O=C(O)C1=CC(Cl)=CC=C1NC(COCC(N2CCN(C(C3=CC=CC=C3)C4=CC=CC=C4)CC2)=O)=O.[Na+] |
| Synonyms | TM 5275, TM-5275 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 96 mg/mL (176.48 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.35 mL | 91.75 mL | 183.49 mL |
| 0.5 mM | 3.67 mL | 18.35 mL | 36.7 mL |
| 1 mM | 1.83 mL | 9.17 mL | 18.35 mL |
| 5 mM | 0.37 mL | 1.83 mL | 3.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
