Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Trimethobenzamide hydrochloride is a blocker of the D2 receptor. Trimethobenzamide is an antiemetic used to prevent nausea and vomiting. |
|---|
| Catalog Num | A17648 |
|---|---|
| Formula | C21H29ClN2O5 |
| Molecular Weight | 424.92 |
| CAS Number | 554-92-7 |
| SMILES | O=C(NCC1=CC=C(OCCN(C)C)C=C1)C2=CC(OC)=C(OC)C(OC)=C2.Cl |
| Synonyms | Ro 2-9578, Ro2-9578, Ro-2-9578 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (190.62 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.53 mL | 117.67 mL | 235.34 mL |
| 0.5 mM | 4.71 mL | 23.53 mL | 47.07 mL |
| 1 mM | 2.35 mL | 11.77 mL | 23.53 mL |
| 5 mM | 0.47 mL | 2.35 mL | 4.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
