Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | U 73122 is a phospholipase C inhibitor. It inhibits agonist-induced platelet aggregation with IC50 values of 1-5 uM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14339 |
|---|---|
| Formula | C29H40N2O3 |
| Molecular Weight | 464.65 |
| CAS Number | 112648-68-7 |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2NCCCCCCN4C(=O)C=CC4=O)CCC5=C3C=CC(=C5)OC |
| Synonyms | U73122, U-73122 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: <1 mg/mL | |
| Water | Insoluble | ||
| Ethanol | DMF: Warmed: 22 mg/mL (47.35 mM) | ||
| In vivo | 5% DMF+40% PEG300+5% Tween80+50% ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.52 mL | 107.61 mL | 215.22 mL |
| 0.5 mM | 4.3 mL | 21.52 mL | 43.04 mL |
| 1 mM | 2.15 mL | 10.76 mL | 21.52 mL |
| 5 mM | 0.43 mL | 2.15 mL | 4.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
