Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | UCB9608 is a potent, selective and orally active PI4KIIIβ inhibitor, with an IC50 of 11 nM, selective over PI3KC2 α, β, and γ lipid kinases. |
|---|
| Catalog Num | A19941 |
|---|---|
| Formula | C20H26N8O2 |
| Molecular Weight | 410.47 |
| CAS Number | 1616413-96-7 |
| SMILES | NC1=NC(N2CCN(C(NC3=CC=C(OC)C=C3C)=O)C[C@@H]2C)=C4C(N(C)N=C4)=N1 |
| Synonyms | UCB-9608; UCB 9608 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (180.28 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.36 mL | 121.81 mL | 243.62 mL |
| 0.5 mM | 4.87 mL | 24.36 mL | 48.72 mL |
| 1 mM | 2.44 mL | 12.18 mL | 24.36 mL |
| 5 mM | 0.49 mL | 2.44 mL | 4.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
