Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | UNBS5162 is a novel naphthalimide that decreases CXCL chemokine expression in experimental prostate cancers; the mean antiproliferative activity IC50 value is 17.9 uM for 9 cancer cell lines; hydrolysis product of UNBS3157. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15439 |
|---|---|
| Formula | C17H18N4O3 |
| Molecular Weight | 326.35 |
| CAS Number | 956590-23-1 |
| SMILES | CN(C)CCN1C(=O)C2=CC=CC3=CC(=CC(=C32)C1=O)NC(=O)N |
| Synonyms | UNBS 5162, UNBS-5162 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 16 mg/mL (49.03 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.64 mL | 153.21 mL | 306.42 mL |
| 0.5 mM | 6.13 mL | 30.64 mL | 61.28 mL |
| 1 mM | 3.06 mL | 15.32 mL | 30.64 mL |
| 5 mM | 0.61 mL | 3.06 mL | 6.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
