Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | UNC2250 is a potent and selective Mer Kinase inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14143 |
|---|---|
| Formula | C24H36N6O2 |
| Molecular Weight | 440.58 |
| CAS Number | 1493694-70-4 |
| SMILES | CCCCNC1=NC=C(C(=N1)NC2CCC(CC2)O)C3=NC=C(C=C3)CN4CCOCC4 |
| Synonyms | UNC-2250,UNC2250 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 2 mg/mL (4.53 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+30% PEG 300+ddH2O | 0.4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.7 mL | 113.49 mL | 226.97 mL |
| 0.5 mM | 4.54 mL | 22.7 mL | 45.39 mL |
| 1 mM | 2.27 mL | 11.35 mL | 22.7 mL |
| 5 mM | 0.45 mL | 2.27 mL | 4.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
