Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Urolithin A, a gut-microbial metabolite of ellagic acid, exerts anti-inflammatory, antiproliferative, and antioxidant properties. Urolithin A induces autophagy and apoptosis, suppresses cell cycle progression, and inhibits DNA synthesis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20426 |
|---|---|
| Formula | C13H8O4 |
| Molecular Weight | 228.2 |
| CAS Number | 1143-70-0 |
| SMILES | O=C1C2=CC(O)=CC=C2C3=CC=C(O)C=C3O1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (192.81 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.82 mL | 219.11 mL | 438.21 mL |
| 0.5 mM | 8.76 mL | 43.82 mL | 87.64 mL |
| 1 mM | 4.38 mL | 21.91 mL | 43.82 mL |
| 5 mM | 0.88 mL | 4.38 mL | 8.76 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
