Loading distributor info...
| Description | Verdiperstat (AZD3241) is a selective, irreversible and orally active myeloperoxidase (MPO) inhibitor, with an IC50 of 630 nM, and can be used in the research of neurodegenerative brain disorders. |
|---|
| Catalog Num | A22041 |
|---|---|
| Formula | C11H15N3O2S |
| Molecular Weight | 253.32 |
| CAS Number | 890655-80-8 |
| SMILES | O=C(N1)C(NC=C2)=C2N(CCOC(C)C)C1=S |
| Synonyms | AZD3241, AZD 3241, AZD-3241 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (181.58 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (35.52 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.48 mL | 197.38 mL | 394.76 mL |
| 0.5 mM | 7.9 mL | 39.48 mL | 78.95 mL |
| 1 mM | 3.95 mL | 19.74 mL | 39.48 mL |
| 5 mM | 0.79 mL | 3.95 mL | 7.9 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
