Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | VUF10460 is a non-imidazole histamine H4 receptor agonist; binds to rat H4 receptor with a pKi of 7.46. |
|---|
| Catalog Num | A20484 |
|---|---|
| Formula | C15H19N5 |
| Molecular Weight | 269.34 |
| CAS Number | 1028327-66-3 |
| SMILES | NC1=NC(C2=CC=CC=C2)=CC(N3CCN(C)CC3)=N1 |
| Synonyms | VUF 10460, VUF-10460 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 51 mg/mL (189.35 mM) | |
| Water | Insoluble | ||
| Ethanol | 51 mg/mL (189.35 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.13 mL | 185.64 mL | 371.28 mL |
| 0.5 mM | 7.43 mL | 37.13 mL | 74.26 mL |
| 1 mM | 3.71 mL | 18.56 mL | 37.13 mL |
| 5 mM | 0.74 mL | 3.71 mL | 7.43 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
