Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Xylometazoline hydrochloride is an α-adrenoceptor agonist commonly used as nasal decongestant. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17251 |
|---|---|
| Formula | C16H25ClN2 |
| Molecular Weight | 280.84 |
| CAS Number | 1218-35-5 |
| SMILES | CC1=C(CC2=NCCN2)C(C)=CC(C(C)(C)C)=C1.[H]Cl |
| Synonyms | Xylometazoline HCl; xylomethazoline. Brand name: Otrivine; Amidrin; Balkis; Chlorohist-LA; Decongest; espa-rhin; Gelonasal. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 26 mg/mL (92.58 mM) | |
| Water | 54 mg/mL (192.28 mM) | ||
| Ethanol | 54 mg/mL (192.28 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.61 mL | 178.04 mL | 356.07 mL |
| 0.5 mM | 7.12 mL | 35.61 mL | 71.21 mL |
| 1 mM | 3.56 mL | 17.8 mL | 35.61 mL |
| 5 mM | 0.71 mL | 3.56 mL | 7.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
