Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | YU238259 is an inhibitor of homology-dependent DNA repair (HDR), used for cancer research. |
|---|
| Catalog Num | A20614 |
|---|---|
| Formula | C22H22ClN3O4S |
| Molecular Weight | 459.95 |
| CAS Number | 1943733-16-1 |
| SMILES | COC1=CC=C(S(NCC2=CC=C(C(NCCC3=CC=C(Cl)C=N3)=O)C=C2)(=O)=O)C=C1 |
| Synonyms | YU 238259, YU-238259 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (186.97 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.74 mL | 108.71 mL | 217.41 mL |
| 0.5 mM | 4.35 mL | 21.74 mL | 43.48 mL |
| 1 mM | 2.17 mL | 10.87 mL | 21.74 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
