Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ZM 306416 is a VEGF receptor tyrosine kinase inhibitor that inhibits KDR (IC50 = 100 nM) and Flt (IC50 = 2 uM) tyrosine kinases. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11955 |
|---|---|
| Formula | C16H13ClFN3O2 |
| Molecular Weight | 333.74 |
| CAS Number | 690206-97-4 |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=C(C=C(C=C3)Cl)F)OC |
| Synonyms | ZM-306416, ZM306416 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (176.78 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.96 mL | 149.82 mL | 299.63 mL |
| 0.5 mM | 5.99 mL | 29.96 mL | 59.93 mL |
| 1 mM | 3 mL | 14.98 mL | 29.96 mL |
| 5 mM | 0.6 mL | 3 mL | 5.99 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
