Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Zoledronic acid is a bisphosphonate which used to multiple myeloma and prostate cancer treament. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11010 |
|---|---|
| Formula | C5H10N2O7P2 |
| Molecular Weight | 272.1 |
| CAS Number | 118072-93-8 |
| SMILES | C1=CN(C=N1)CC(O)(P(=O)(O)O)P(=O)(O)O |
| Synonyms | Zometa, Zomera, Aclasta and Reclast |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | <1 mg/mL | |
| Water | Insoluble | ||
| Ethanol | 0.1M NaOH (aq): 36 mg/mL (132.31 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.75 mL | 183.76 mL | 367.51 mL |
| 0.5 mM | 7.35 mL | 36.75 mL | 73.5 mL |
| 1 mM | 3.68 mL | 18.38 mL | 36.75 mL |
| 5 mM | 0.74 mL | 3.68 mL | 7.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
