Loading distributor info...
| Description | Bufalin is an active component isolated from Chan Su, acts as a potent Na+/K+-ATPase inhibitor, binds to the subunit α1, α2 and α3, with Kd of 42.5, 45 and 40 nM, respectively. Anti-cancer activity. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12022 |
|---|---|
| Formula | C24H34O4 |
| Molecular Weight | 386.5 |
| CAS Number | 465-21-4 |
| SMILES | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@@]3(CC[C@@H]4C5=COC(=O)C=C5)O)C)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (186.28 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 37 mg/mL (95.72 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.87 mL | 129.37 mL | 258.73 mL |
| 0.5 mM | 5.17 mL | 25.87 mL | 51.75 mL |
| 1 mM | 2.59 mL | 12.94 mL | 25.87 mL |
| 5 mM | 0.52 mL | 2.59 mL | 5.17 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
