Loading distributor info...
| Description | CK-636 is a Arp2/3 complex inhibitor. CK-636 binds between Arp2 and Arp3, where it appears to block movement of Arp2 and Arp3 into their active conformation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13827 |
|---|---|
| Formula | C16H16N2OS |
| Molecular Weight | 284.09833 |
| CAS Number | 442632-72-6 |
| SMILES | CC1=C(C2=CC=CC=C2N1)CCNC(=O)C3=CC=CS3 |
| Synonyms | CK636, CK 636 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (182.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 46 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.2 mL | 176 mL | 351.99 mL |
| 0.5 mM | 7.04 mL | 35.2 mL | 70.4 mL |
| 1 mM | 3.52 mL | 17.6 mL | 35.2 mL |
| 5 mM | 0.7 mL | 3.52 mL | 7.04 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
