Loading distributor info...
| Description | Costunolide is an Inhibitor of human telomerase activity (IC50 = 65 μM in MCF-7 breast cancer cells). It is described to act as an antioxidant, anti-mycobacterial, anti-inflammatory, and anti-viral, with cytotoxic activity. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10240 |
|---|---|
| Formula | C15H20O2 |
| Molecular Weight | 232.3 |
| CAS Number | 553-21-9 |
| SMILES | CC1=CCC/C(=C/[C@@H]2[C@@H](CC1)C(=C)C(=O)O2)/C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 43 mg/mL (185.08 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (4.3 mM) | ||
| In vivo | 2% DMSO+corn oil | 9 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.05 mL | 215.24 mL | 430.48 mL |
| 0.5 mM | 8.61 mL | 43.05 mL | 86.1 mL |
| 1 mM | 4.3 mL | 21.52 mL | 43.05 mL |
| 5 mM | 0.86 mL | 4.3 mL | 8.61 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
