Loading distributor info...
| Description | E3330 is a potent and selective APE1(Ref-1) inhibitor, which suppressed NF-kappa B DNA-binding activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14440 |
|---|---|
| Formula | C21H30O6 |
| Molecular Weight | 378.46 |
| CAS Number | 136164-66-4 |
| SMILES | CCCCCCCCCC(=CC1=C(C(=O)C(=C(C1=O)OC)OC)C)C(=O)O |
| Synonyms | E 3330, E-3330 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (190.24 mM) | |
| Water | Insoluble | ||
| Ethanol | 72 mg/mL (190.24 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.42 mL | 132.11 mL | 264.23 mL |
| 0.5 mM | 5.28 mL | 26.42 mL | 52.85 mL |
| 1 mM | 2.64 mL | 13.21 mL | 26.42 mL |
| 5 mM | 0.53 mL | 2.64 mL | 5.28 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
