Loading distributor info...
| Description | Meclofenamate Sodium is a dual COX-1/COX-2 inhibitor with IC50 of 40 nM and 50 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12520 |
|---|---|
| Formula | C14H11Cl2NO2.Na |
| Molecular Weight | 318.13 |
| CAS Number | 6385-02-0 |
| SMILES | CC1=C(C(=C(C=C1)Cl)NC2=CC=CC=C2C(=O)[O-])Cl.[Na+] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (188.6 mM) | |
| Water | 60 mg/mL (188.6 mM) | ||
| Ethanol | 60 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.43 mL | 157.17 mL | 314.34 mL |
| 0.5 mM | 6.29 mL | 31.43 mL | 62.87 mL |
| 1 mM | 3.14 mL | 15.72 mL | 31.43 mL |
| 5 mM | 0.63 mL | 3.14 mL | 6.29 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
