Loading distributor info...
| Description | Nordihydroguaiaretic acid is a natural phenolic compound isolated from the creosote bush Larrea divaricata, which has anti-tumor activities both in vitro and in vivo. Its analogs are in clinical development for use in refractory solid tumors. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15190 |
|---|---|
| Formula | C18H22O4 |
| Molecular Weight | 302.36 |
| CAS Number | 500-38-9 |
| SMILES | CC(CC1=CC(=C(C=C1)O)O)C(C)CC2=CC(=C(C=C2)O)O |
| Synonyms | NDGA |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (175.28 mM) | |
| Water | Insoluble | ||
| Ethanol | 53 mg/mL (175.28 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.07 mL | 165.37 mL | 330.73 mL |
| 0.5 mM | 6.61 mL | 33.07 mL | 66.15 mL |
| 1 mM | 3.31 mL | 16.54 mL | 33.07 mL |
| 5 mM | 0.66 mL | 3.31 mL | 6.61 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
