Loading distributor info...
| Description | O6-Benzylguanine is an effective substrate and efficient inactivator of DNA alkyltransferase. O6-Benzylguanine is an inhibitor of MGMT. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A13706 |
|---|---|
| Formula | C12H11N5O |
| Molecular Weight | 241.25 |
| CAS Number | 19916-73-5 |
| SMILES | NC1=NC2=NC=NC2=C(OCC3=CC=CC=C3)N1 |
| Synonyms | CCRIS 9383 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 41 mg/mL (169.95 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.45 mL | 207.25 mL | 414.51 mL |
| 0.5 mM | 8.29 mL | 41.45 mL | 82.9 mL |
| 1 mM | 4.15 mL | 20.73 mL | 41.45 mL |
| 5 mM | 0.83 mL | 4.15 mL | 8.29 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
