Loading distributor info...
| Description | SBC-115076 is an anti-proprotein convertase subtilisin kexin type 9 (anti-PCSK9) compounds, for the treatment and/or prevention of cardiovascular diseases. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15769 |
|---|---|
| Formula | C31H33N3O5 |
| Molecular Weight | 527.61 |
| CAS Number | 489415-96-5 |
| SMILES | CC1=C(C=CC(=C1)C(=C2C(N(C(=O)C2=O)CCCN3CCOCC3)C4=CC=NC=C4)O)OCC5=CC=CC=C5 |
| Synonyms | SBC 115076, SBC115076 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 28 mg/mL (53.06 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+45% PEG 300+ddH2O | 6 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.95 mL | 94.77 mL | 189.53 mL |
| 0.5 mM | 3.79 mL | 18.95 mL | 37.91 mL |
| 1 mM | 1.9 mL | 9.48 mL | 18.95 mL |
| 5 mM | 0.38 mL | 1.9 mL | 3.79 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
