Loading distributor info...
| Description | TH287 is a potent inhibitor of MTH1 (NUDT1) with an IC50 value of 0.8 nM, less potent for MTH2, NUDT5, NUDT12, NUDT14, and NUDT16, | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15536 |
|---|---|
| Formula | C11H10Cl2N4 |
| Molecular Weight | 269.13 |
| CAS Number | 1609960-30-6 |
| SMILES | CNC1=NC(=NC(=C1)C2=C(C(=CC=C2)Cl)Cl)N |
| Synonyms | TH-287, TH 287 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (178.35 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 9 mg/mL (33.44 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.16 mL | 185.78 mL | 371.57 mL |
| 0.5 mM | 7.43 mL | 37.16 mL | 74.31 mL |
| 1 mM | 3.72 mL | 18.58 mL | 37.16 mL |
| 5 mM | 0.74 mL | 3.72 mL | 7.43 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
