c-Kit/VEGFR2/PDGFRβ inhibitor
Loading distributor info...
| Description | Toceranib phosphate is a kinase inhibitor with both antitumor and antiangiogenic activity through inhibition of KIT, vascular endothelial growth factor receptor 2, and PDGFRβ. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15263 |
|---|---|
| Formula | C22H28FN4O6P |
| Molecular Weight | 494.45 |
| CAS Number | 874819-74-6 |
| SMILES | CC1=C(NC(=C1C(=O)NCCN2CCCC2)C)C=C3C4=C(C=CC(=C4)F)NC3=O.OP(=O)(O)O |
| Synonyms | SU 11654, PHA 291639, SU11654, SU-11654, PHA-291639, PHA291639 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 2 mg/mL (4.04 mM) | |
| Water | 2 mg/mL (4.04 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.22 mL | 101.12 mL | 202.24 mL |
| 0.5 mM | 4.04 mL | 20.22 mL | 40.45 mL |
| 1 mM | 2.02 mL | 10.11 mL | 20.22 mL |
| 5 mM | 0.4 mL | 2.02 mL | 4.04 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
