Loading distributor info...
| Description | Tolfenamic Acid is a COX-2 inhibitor with IC50 of 0.2 μM. It is one of the class of non-steroidal anti-inflammatory drugs (NSAIDs). It is used to treat the symptoms of migraine. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11693 |
|---|---|
| Formula | C14H12ClNO2 |
| Molecular Weight | 261.7 |
| CAS Number | 13710-19-5 |
| SMILES | CC1=C(C=CC=C1Cl)NC2=CC=CC=C2C(=O)O |
| Synonyms | TA |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (191.06 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.21 mL | 191.06 mL | 382.12 mL |
| 0.5 mM | 7.64 mL | 38.21 mL | 76.42 mL |
| 1 mM | 3.82 mL | 19.11 mL | 38.21 mL |
| 5 mM | 0.76 mL | 3.82 mL | 7.64 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
