Loading distributor info...
| Description | YC-1 is a direct activator of soluble Guanylyl Cyclase (sGC), independent of Nitric Oxide. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12402 |
|---|---|
| Formula | C19H16N2O2 |
| Molecular Weight | 304.34 |
| CAS Number | 170632-47-0 |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=N2)C4=CC=C(O4)CO |
| Synonyms | YC1, YC 1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (190.57 mM) | |
| Water | Insoluble | ||
| Ethanol | 58 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.86 mL | 164.29 mL | 328.58 mL |
| 0.5 mM | 6.57 mL | 32.86 mL | 65.72 mL |
| 1 mM | 3.29 mL | 16.43 mL | 32.86 mL |
| 5 mM | 0.66 mL | 3.29 mL | 6.57 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
