Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 2-Aminoethyl diphenylborinate (2-APB) is a cell-permeable inhibitor of IP3R. 2-Aminoethyl diphenylborinate also inhibits the store-operated Ca2+ (SOC) channel and activates some TRP channels (V1, V2 and V3). |
|---|
| Catalog Num | A18088 |
|---|---|
| Formula | C14H16BNO |
| Molecular Weight | 225.1 |
| CAS Number | 524-95-8 |
| SMILES | NCCOB(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonyms | 2-Aminoethyl Diphenylborinate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 39 mg/mL (173.26 mM) | |
| Water | Insoluble | ||
| Ethanol | 20 mg/mL (88.85 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.42 mL | 222.12 mL | 444.25 mL |
| 0.5 mM | 8.88 mL | 44.42 mL | 88.85 mL |
| 1 mM | 4.44 mL | 22.21 mL | 44.42 mL |
| 5 mM | 0.89 mL | 4.44 mL | 8.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
