Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 3-Aminopropionitrile fumarate (2:1) is a lathyrogen which inhibits crosslinking of collagen. |
|---|
| Catalog Num | A19629 |
|---|---|
| Formula | C4H4O4.2C3H6N2 |
| Molecular Weight | 256.26 |
| CAS Number | 2079-89-2 |
| SMILES | NCCC#N.OC(/C=C/C(O)=O)=O.NCCC#N |
| Synonyms | Di-β-aminopropionitrile fumarate; β-Aminopropionitrile fumarate; β-Ammoniumpropionitrile hemifumarate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 49 mg/mL (191.21 mM) | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.02 mL | 195.11 mL | 390.23 mL |
| 0.5 mM | 7.8 mL | 39.02 mL | 78.05 mL |
| 1 mM | 3.9 mL | 19.51 mL | 39.02 mL |
| 5 mM | 0.78 mL | 3.9 mL | 7.8 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
