Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 3-Nitro-L-tyrosine is a biomarker of nitrogen free radical species modified proteins in systemic autoimmunogenic conditions. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18665 |
|---|---|
| Formula | C9H10N2O5 |
| Molecular Weight | 226.19 |
| CAS Number | 621-44-3 |
| SMILES | N[C@@H](CC1=CC([N+]([O-])=O)=C(C=C1)O)C(O)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 2 mg/mL (8.84 mM) | |
| Water | 1 mg/mL (4.42 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.21 mL | 221.05 mL | 442.11 mL |
| 0.5 mM | 8.84 mL | 44.21 mL | 88.42 mL |
| 1 mM | 4.42 mL | 22.11 mL | 44.21 mL |
| 5 mM | 0.88 mL | 4.42 mL | 8.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
