Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 3b-Hydroxy-5-cholenoic acid is a monohydroxy bile acid of endogenous origin and could be found in children with the syndrome of hepatic ductular hypoplasia. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18596 |
|---|---|
| Formula | C24H38O3 |
| Molecular Weight | 374.56 |
| CAS Number | 5255-17-4 |
| SMILES | C[C@H](CCC(O)=O)[C@H]1CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (13.34 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (10.67 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.7 mL | 133.49 mL | 266.98 mL |
| 0.5 mM | 5.34 mL | 26.7 mL | 53.4 mL |
| 1 mM | 2.67 mL | 13.35 mL | 26.7 mL |
| 5 mM | 0.53 mL | 2.67 mL | 5.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
