Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 5α-Cholestan-3β-ol is a derivitized steroid compound, which is isolated from the testes of White Carneau pigeons. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19653 |
|---|---|
| Formula | C27H48O |
| Molecular Weight | 388.67 |
| CAS Number | 80-97-7 |
| SMILES | C[C@@]12[C@](CC[C@]2([H])[C@H](C)CCCC(C)C)([H])[C@@]3([H])[C@]([C@@]4([C@@](C[C@@H](O)CC4)([H])CC3)C)([H])CC1 |
| Synonyms | Dihydrocholesterol; 5α-Cholestanol; NSC 18188, NSC18188, NSC-18188 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 2 mg/mL (5.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 36 mg/mL (92.61 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.73 mL | 128.64 mL | 257.29 mL |
| 0.5 mM | 5.15 mL | 25.73 mL | 51.46 mL |
| 1 mM | 2.57 mL | 12.86 mL | 25.73 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
