Loading distributor info...
| Description | 5-Methoxyflavone, belonged to Flavonoid family, is a DNA polymerase-beta inhibitor and neuroprotective agent against beta-amyloid toxicity. |
|---|
| Catalog Num | A19698 |
|---|---|
| Formula | C16H12O3 |
| Molecular Weight | 252.26 |
| CAS Number | 42079-78-7 |
| SMILES | O=C1C=C(C2=CC=CC=C2)OC3=CC=CC(OC)=C13 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (194.24 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.64 mL | 198.21 mL | 396.42 mL |
| 0.5 mM | 7.93 mL | 39.64 mL | 79.28 mL |
| 1 mM | 3.96 mL | 19.82 mL | 39.64 mL |
| 5 mM | 0.79 mL | 3.96 mL | 7.93 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
