Loading distributor info...
| Description | ABX-464, also known as SPL-464, is an inhibitor of the HIV replication potentially for the treatment of HIV infection. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16912 |
|---|---|
| Formula | C16H10ClF3N2O |
| Molecular Weight | 338.71 |
| CAS Number | 1258453-75-6 |
| SMILES | FC(F)(F)OC1=CC=C(NC2=NC3=C(Cl)C=CC=C3C=C2)C=C1 |
| Synonyms | ABX464, ABX 464, SPL-464, SPL464, SPL 464 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (171.24 mM) | |
| Water | Insoluble | ||
| Ethanol | 58 mg/mL (171.24 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.52 mL | 147.62 mL | 295.24 mL |
| 0.5 mM | 5.9 mL | 29.52 mL | 59.05 mL |
| 1 mM | 2.95 mL | 14.76 mL | 29.52 mL |
| 5 mM | 0.59 mL | 2.95 mL | 5.9 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
