Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Aceclofenac is a cyclooxygenase-2 inhibitor used to treat osteoarthritis, rheumatoid arthritis and ankylosing spondylitis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17433 |
|---|---|
| Formula | C16H13Cl2NO4 |
| Molecular Weight | 354.18 |
| CAS Number | 89796-99-6 |
| SMILES | O=C(OCC(O)=O)CC1=CC=CC=C1NC2=C(Cl)C=CC=C2Cl |
| Synonyms | Aceclofenac; YT-919; YT 919; YT919; Airtal; Beofenac |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (189.16 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.23 mL | 141.17 mL | 282.34 mL |
| 0.5 mM | 5.65 mL | 28.23 mL | 56.47 mL |
| 1 mM | 2.82 mL | 14.12 mL | 28.23 mL |
| 5 mM | 0.56 mL | 2.82 mL | 5.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
